C19H17NO4 — CID 7747305
prop-2-enyl 2,7,9-trimethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 7747305) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is prop-2-enyl 2,7,9-trimethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | prop-2-enyl 2,7,9-trimethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7747305 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | prop-2-enyl 2,7,9-trimethyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | C=CCOC(=O)c1cc2c(=O)c3cc(C)cc(C)c3oc2nc1C |
| InChI | InChI=1S/C19H17NO4/c1-5-6-23-19(22)13-9-15-16(21)14-8-10(2)7-11(3)17(14)24-18(15)20-12(13)4/h5,7-9H,1,6H2,2-4H3 |
| InChIKey | GKSFBVPUYBYTQL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|