About 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene
2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene (PubChem CID 77475574) has the molecular formula C16H14S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene |
| PubChem CID | 77475574 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene |
| SMILES | C1=CCC(c2ccc(-c3ccccc3)s2)C=C1 |
| InChI | InChI=1S/C16H14S/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-9,11-12,14H,10H2 |
| InChIKey | VDVSKHWSAAWRCI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene?
The IUPAC name of 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene (CID 77475574) is 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene is C1=CCC(c2ccc(-c3ccccc3)s2)C=C1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene?
The InChIKey is VDVSKHWSAAWRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14S/c1-3-7-13(8-4-1)15-11-12-16(17-15)14-9-5-2-6-10-14/h1-9,11-12,14H,10H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene?
2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene has a molecular weight of 238.36 g/mol, XLogP of 5.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-yl-5-phenylthiophene is sourced from PubChem (CID 77475574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).