About (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone
(2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone (PubChem CID 774758) has the molecular formula C16H12N2OS
and a molecular weight of 280.35 g/mol. Its IUPAC name is (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone.
Molecular Properties
| Compound Name | (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
| PubChem CID | 774758 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone |
| SMILES | Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C16H12N2OS/c17-16-18-13(11-7-3-1-4-8-11)15(20-16)14(19)12-9-5-2-6-10-12/h1-10H,(H2,17,18) |
| InChIKey | DWJFTFVMQOCWNR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
The IUPAC name of (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone (CID 774758) is (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone.
What is the SMILES notation for (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
The canonical SMILES for (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone is Nc1nc(-c2ccccc2)c(C(=O)c2ccccc2)s1.
What is the InChIKey of (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
The InChIKey is DWJFTFVMQOCWNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS/c17-16-18-13(11-7-3-1-4-8-11)15(20-16)14(19)12-9-5-2-6-10-12/h1-10H,(H2,17,18).
What are the key properties of (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone?
(2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone has a molecular weight of 280.35 g/mol, XLogP of 3.62, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-phenyl-1,3-thiazol-5-yl)-phenylmethanone is sourced from PubChem (CID 774758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).