C25H36FN7O2 — CID 77477165
1-(2-amino-3,3-dimethylbutanoyl)-6-[[4-(4-fluorophenyl)triazol-1-yl]methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 77477165) has the molecular formula C25H36FN7O2 and a molecular weight of 485.61 g/mol. Its IUPAC name is 1-(2-amino-3,3-dimethylbutanoyl)-6-[[4-(4-fluorophenyl)triazol-1-yl]methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | 1-(2-amino-3,3-dimethylbutanoyl)-6-[[4-(4-fluorophenyl)triazol-1-yl]methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 77477165 |
| Molecular Formula | C25H36FN7O2 |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 1-(2-amino-3,3-dimethylbutanoyl)-6-[[4-(4-fluorophenyl)triazol-1-yl]methyl]-N-propan-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | CC(C)NC(=O)N1CC(Cn2cc(-c3ccc(F)cc3)nn2)C2C1CCN2C(=O)C(N)C(C)(C)C |
| InChI | InChI=1S/C25H36FN7O2/c1-15(2)28-24(35)33-13-17(12-31-14-19(29-30-31)16-6-8-18(26)9-7-16)21-20(33)10-11-32(21)23(34)22(27)25(3,4)5/h6-9,14-15,17,20-22H,10-13,27H2,1-5H3,(H,28,35) |
| InChIKey | SCNLQARIVIGUOQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |