C28H38BN3O6 — CID 77479303
methyl N-[3-methyl-1-oxo-1-[2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate (PubChem CID 77479303) has the molecular formula C28H38BN3O6 and a molecular weight of 523.44 g/mol. Its IUPAC name is methyl N-[3-methyl-1-oxo-1-[2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate.
| Compound Name | methyl N-[3-methyl-1-oxo-1-[2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 77479303 |
| Molecular Formula | C28H38BN3O6 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.29 |
| IUPAC Name | methyl N-[3-methyl-1-oxo-1-[2-[[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]carbamoyl]pyrrolidin-1-yl]butan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)N1CCCC1C(=O)Nc1ccc2cc(B3OC(C)(C)C(C)(C)O3)ccc2c1)C(C)C |
| InChI | InChI=1S/C28H38BN3O6/c1-17(2)23(31-26(35)36-7)25(34)32-14-8-9-22(32)24(33)30-21-13-11-18-15-20(12-10-19(18)16-21)29-37-27(3,4)28(5,6)38-29/h10-13,15-17,22-23H,8-9,14H2,1-7H3,(H,30,33)(H,31,35) |
| InChIKey | PMTNEIBOJZCXGJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|