C37H56N4O3 — CID 77481042
tert-butyl 2,2-dimethyl-4-[4-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]butyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 77481042) has the molecular formula C37H56N4O3 and a molecular weight of 604.88 g/mol. Its IUPAC name is tert-butyl 2,2-dimethyl-4-[4-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]butyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2-dimethyl-4-[4-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]butyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 77481042 |
| Molecular Formula | C37H56N4O3 |
| Molecular Weight | 604.88 g/mol |
| Exact Mass | 604.44 |
| IUPAC Name | tert-butyl 2,2-dimethyl-4-[4-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]butyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(CCCCN2CCN(c3cccc(-c4ccc5c(c4)C(C)(C)CCC5(C)C)n3)CC2)COC1(C)C |
| InChI | InChI=1S/C37H56N4O3/c1-34(2,3)44-33(42)41-28(26-43-37(41,8)9)13-10-11-20-39-21-23-40(24-22-39)32-15-12-14-31(38-32)27-16-17-29-30(25-27)36(6,7)19-18-35(29,4)5/h12,14-17,25,28H,10-11,13,18-24,26H2,1-9H3 |
| InChIKey | OXEKRBYFRZKHJS-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.88 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|