C27H40O4 — CID 77482268
[10,13-dimethyl-12-oxo-17-(5-oxohexan-2-yl)-1,2,3,4,5,6,7,8,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 77482268) has the molecular formula C27H40O4 and a molecular weight of 428.61 g/mol. Its IUPAC name is [10,13-dimethyl-12-oxo-17-(5-oxohexan-2-yl)-1,2,3,4,5,6,7,8,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [10,13-dimethyl-12-oxo-17-(5-oxohexan-2-yl)-1,2,3,4,5,6,7,8,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 77482268 |
| Molecular Formula | C27H40O4 |
| Molecular Weight | 428.61 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | [10,13-dimethyl-12-oxo-17-(5-oxohexan-2-yl)-1,2,3,4,5,6,7,8,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)CCC(C)C1CCC2C3CCC4CC(OC(C)=O)CCC4(C)C3=CC(=O)C12C |
| InChI | InChI=1S/C27H40O4/c1-16(6-7-17(2)28)22-10-11-23-21-9-8-19-14-20(31-18(3)29)12-13-26(19,4)24(21)15-25(30)27(22,23)5/h15-16,19-23H,6-14H2,1-5H3 |
| InChIKey | PGWBQJFLQLTACZ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |