C23H24ClNO — CID 77488339
5-(4-chlorophenyl)-6,7a-dimethyl-4-(4-methylphenyl)-3,3a,4,5-tetrahydro-2H-isoindol-1-one (PubChem CID 77488339) has the molecular formula C23H24ClNO and a molecular weight of 365.90 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6,7a-dimethyl-4-(4-methylphenyl)-3,3a,4,5-tetrahydro-2H-isoindol-1-one.
| Compound Name | 5-(4-chlorophenyl)-6,7a-dimethyl-4-(4-methylphenyl)-3,3a,4,5-tetrahydro-2H-isoindol-1-one |
|---|---|
| PubChem CID | 77488339 |
| Molecular Formula | C23H24ClNO |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 5-(4-chlorophenyl)-6,7a-dimethyl-4-(4-methylphenyl)-3,3a,4,5-tetrahydro-2H-isoindol-1-one |
| SMILES | CC1=CC2(C)C(=O)NCC2C(c2ccc(C)cc2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClNO/c1-14-4-6-17(7-5-14)21-19-13-25-22(26)23(19,3)12-15(2)20(21)16-8-10-18(24)11-9-16/h4-12,19-21H,13H2,1-3H3,(H,25,26) |
| InChIKey | FYOWNGHBOWUSFB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|