About 5-methoxy-6,6-dimethyloxan-2-ol
5-methoxy-6,6-dimethyloxan-2-ol (PubChem CID 77491775) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 5-methoxy-6,6-dimethyloxan-2-ol.
Molecular Properties
| Compound Name | 5-methoxy-6,6-dimethyloxan-2-ol |
| PubChem CID | 77491775 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 5-methoxy-6,6-dimethyloxan-2-ol |
| SMILES | COC1CCC(O)OC1(C)C |
| InChI | InChI=1S/C8H16O3/c1-8(2)6(10-3)4-5-7(9)11-8/h6-7,9H,4-5H2,1-3H3 |
| InChIKey | ABBDPLAVHOCSCU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-6,6-dimethyloxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6,6-dimethyloxan-2-ol?
The IUPAC name of 5-methoxy-6,6-dimethyloxan-2-ol (CID 77491775) is 5-methoxy-6,6-dimethyloxan-2-ol.
What is the SMILES notation for 5-methoxy-6,6-dimethyloxan-2-ol?
The canonical SMILES for 5-methoxy-6,6-dimethyloxan-2-ol is COC1CCC(O)OC1(C)C.
What is the InChIKey of 5-methoxy-6,6-dimethyloxan-2-ol?
The InChIKey is ABBDPLAVHOCSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-8(2)6(10-3)4-5-7(9)11-8/h6-7,9H,4-5H2,1-3H3.
What are the key properties of 5-methoxy-6,6-dimethyloxan-2-ol?
5-methoxy-6,6-dimethyloxan-2-ol has a molecular weight of 160.21 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6,6-dimethyloxan-2-ol is sourced from PubChem (CID 77491775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).