C36H50F2N2O5 — CID 77492312
3-[2-[3-[1-(cyclopropylmethyl)-3-phenylazetidin-3-yl]-4-hydroxyphenyl]ethoxy]-N-[1-(4,4-difluorocyclohexyl)ethyl]-N-(2,2-dimethoxyethyl)propanamide (PubChem CID 77492312) has the molecular formula C36H50F2N2O5 and a molecular weight of 628.80 g/mol. Its IUPAC name is 3-[2-[3-[1-(cyclopropylmethyl)-3-phenylazetidin-3-yl]-4-hydroxyphenyl]ethoxy]-N-[1-(4,4-difluorocyclohexyl)ethyl]-N-(2,2-dimethoxyethyl)propanamide.
| Compound Name | 3-[2-[3-[1-(cyclopropylmethyl)-3-phenylazetidin-3-yl]-4-hydroxyphenyl]ethoxy]-N-[1-(4,4-difluorocyclohexyl)ethyl]-N-(2,2-dimethoxyethyl)propanamide |
|---|---|
| PubChem CID | 77492312 |
| Molecular Formula | C36H50F2N2O5 |
| Molecular Weight | 628.80 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 3-[2-[3-[1-(cyclopropylmethyl)-3-phenylazetidin-3-yl]-4-hydroxyphenyl]ethoxy]-N-[1-(4,4-difluorocyclohexyl)ethyl]-N-(2,2-dimethoxyethyl)propanamide |
| SMILES | COC(CN(C(=O)CCOCCc1ccc(O)c(C2(c3ccccc3)CN(CC3CC3)C2)c1)C(C)C1CCC(F)(F)CC1)OC |
| InChI | InChI=1S/C36H50F2N2O5/c1-26(29-13-17-36(37,38)18-14-29)40(23-34(43-2)44-3)33(42)16-20-45-19-15-27-11-12-32(41)31(21-27)35(30-7-5-4-6-8-30)24-39(25-35)22-28-9-10-28/h4-8,11-12,21,26,28-29,34,41H,9-10,13-20,22-25H2,1-3H3 |
| InChIKey | ZRQQSXOZVDJWDN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.80 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|