C19H25F3N2OSi — CID 77492768
6,6-difluoro-5-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine (PubChem CID 77492768) has the molecular formula C19H25F3N2OSi and a molecular weight of 382.50 g/mol. Its IUPAC name is 6,6-difluoro-5-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine.
| Compound Name | 6,6-difluoro-5-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine |
|---|---|
| PubChem CID | 77492768 |
| Molecular Formula | C19H25F3N2OSi |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 6,6-difluoro-5-[2-fluoro-5-(2-trimethylsilylethynyl)phenyl]-5,7,7-trimethyl-2H-1,4-oxazepin-3-amine |
| SMILES | CC1(C)OCC(N)=NC(C)(c2cc(C#C[Si](C)(C)C)ccc2F)C1(F)F |
| InChI | InChI=1S/C19H25F3N2OSi/c1-17(2)19(21,22)18(3,24-16(23)12-25-17)14-11-13(7-8-15(14)20)9-10-26(4,5)6/h7-8,11H,12H2,1-6H3,(H2,23,24) |
| InChIKey | KRNCKBBKOQKOOV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|