C12H9N3 — CID 77499035
4,6,12-triazatricyclo[7.6.0.03,7]pentadeca-1(15),2,5,7,9,11,13-heptaene (PubChem CID 77499035) has the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. Its IUPAC name is 4,6,12-triazatricyclo[7.6.0.03,7]pentadeca-1(15),2,5,7,9,11,13-heptaene.
| Compound Name | 4,6,12-triazatricyclo[7.6.0.03,7]pentadeca-1(15),2,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 77499035 |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4,6,12-triazatricyclo[7.6.0.03,7]pentadeca-1(15),2,5,7,9,11,13-heptaene |
| SMILES | C1=C/N=C\C=c2cc3nc[nH]c3cc2=C1 |
| InChI | InChI=1S/C12H9N3/c1-2-9-6-11-12(15-8-14-11)7-10(9)3-5-13-4-1/h1-8H,(H,14,15)/b2-1?,4-1?,5-3?,9-2?,10-3?,13-4?,13-5- |
| InChIKey | JTTOXVWAJNTFIM-UJRRCQNLSA-N |
| XLogP | 0.72 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |