About 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid
6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid (PubChem CID 77499210) has the molecular formula C15H17NO8
and a molecular weight of 339.30 g/mol. Its IUPAC name is 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid |
| PubChem CID | 77499210 |
| Molecular Formula | C15H17NO8 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2cc(OC3OC(CO)C(O)C(O)C3O)ccc12 |
| InChI | InChI=1S/C15H17NO8/c17-5-10-11(18)12(19)13(20)15(24-10)23-6-1-2-7-8(14(21)22)4-16-9(7)3-6/h1-4,10-13,15-20H,5H2,(H,21,22) |
| InChIKey | KVKJZZMEYYZNDI-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 152.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid?
The IUPAC name of 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid (CID 77499210) is 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid.
What is the SMILES notation for 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid?
The canonical SMILES for 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid is O=C(O)c1c[nH]c2cc(OC3OC(CO)C(O)C(O)C3O)ccc12.
What is the InChIKey of 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid?
The InChIKey is KVKJZZMEYYZNDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO8/c17-5-10-11(18)12(19)13(20)15(24-10)23-6-1-2-7-8(14(21)22)4-16-9(7)3-6/h1-4,10-13,15-20H,5H2,(H,21,22).
What are the key properties of 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid?
6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid has a molecular weight of 339.30 g/mol, XLogP of -0.96, 4 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1H-indole-3-carboxylic acid is sourced from PubChem (CID 77499210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).