C15H11Cl3FNO2 — CID 7751009
(2R)-2-(3-chloro-4-fluorophenoxy)-N-(3,5-dichlorophenyl)propanamide (PubChem CID 7751009) has the molecular formula C15H11Cl3FNO2 and a molecular weight of 362.62 g/mol. Its IUPAC name is (2R)-2-(3-chloro-4-fluorophenoxy)-N-(3,5-dichlorophenyl)propanamide.
| Compound Name | (2R)-2-(3-chloro-4-fluorophenoxy)-N-(3,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 7751009 |
| Molecular Formula | C15H11Cl3FNO2 |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | (2R)-2-(3-chloro-4-fluorophenoxy)-N-(3,5-dichlorophenyl)propanamide |
| SMILES | C[C@@H](Oc1ccc(F)c(Cl)c1)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3FNO2/c1-8(22-12-2-3-14(19)13(18)7-12)15(21)20-11-5-9(16)4-10(17)6-11/h2-8H,1H3,(H,20,21)/t8-/m1/s1 |
| InChIKey | XJDJLDRZJPARNT-MRVPVSSYSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |