C15H12BrClFNO2 — CID 7751301
N-(2-bromo-4-methylphenyl)-2-(3-chloro-4-fluorophenoxy)acetamide (PubChem CID 7751301) has the molecular formula C15H12BrClFNO2 and a molecular weight of 372.62 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-(3-chloro-4-fluorophenoxy)acetamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-(3-chloro-4-fluorophenoxy)acetamide |
|---|---|
| PubChem CID | 7751301 |
| Molecular Formula | C15H12BrClFNO2 |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-(3-chloro-4-fluorophenoxy)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(F)c(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C15H12BrClFNO2/c1-9-2-5-14(11(16)6-9)19-15(20)8-21-10-3-4-13(18)12(17)7-10/h2-7H,8H2,1H3,(H,19,20) |
| InChIKey | ABOXLAJHVCCACT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |