C20H21N3O5 — CID 7752033
[2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(methylamino)-5-nitrobenzoate (PubChem CID 7752033) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(methylamino)-5-nitrobenzoate.
| Compound Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(methylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7752033 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-oxo-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]ethyl] 2-(methylamino)-5-nitrobenzoate |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C20H21N3O5/c1-21-17-10-9-14(23(26)27)11-16(17)20(25)28-12-19(24)22-18-8-4-6-13-5-2-3-7-15(13)18/h2-3,5,7,9-11,18,21H,4,6,8,12H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | AKHUONFWKHGLKH-GOSISDBHSA-N |
| XLogP | 2.99 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|