C17H21NO3 — CID 775256
N-[(2,3-dimethoxyphenyl)methyl]-2-methoxy-5-methylaniline (PubChem CID 775256) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-methoxy-5-methylaniline.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methoxy-5-methylaniline |
|---|---|
| PubChem CID | 775256 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methoxy-5-methylaniline |
| SMILES | COc1ccc(C)cc1NCc1cccc(OC)c1OC |
| InChI | InChI=1S/C17H21NO3/c1-12-8-9-15(19-2)14(10-12)18-11-13-6-5-7-16(20-3)17(13)21-4/h5-10,18H,11H2,1-4H3 |
| InChIKey | LFLKZNKGJNABER-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_D(2)', 'substructure': 'N/A'} |
|---|