C18H18ClNO5S — CID 7752591
[2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate (PubChem CID 7752591) has the molecular formula C18H18ClNO5S and a molecular weight of 395.86 g/mol. Its IUPAC name is [2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate.
| Compound Name | [2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 7752591 |
| Molecular Formula | C18H18ClNO5S |
| Molecular Weight | 395.86 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [2-[[(1R)-1-(2-chlorophenyl)ethyl]amino]-2-oxoethyl] 4-methylsulfonylbenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccc(S(C)(=O)=O)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C18H18ClNO5S/c1-12(15-5-3-4-6-16(15)19)20-17(21)11-25-18(22)13-7-9-14(10-8-13)26(2,23)24/h3-10,12H,11H2,1-2H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | WSNYSOGBYFAMTJ-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |