C22H19N5S — CID 7753322
3-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 7753322) has the molecular formula C22H19N5S and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 7753322 |
| Molecular Formula | C22H19N5S |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[[4-ethyl-5-(2-phenylquinolin-4-yl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | CCn1c(SCCC#N)nnc1-c1cc(-c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C22H19N5S/c1-2-27-21(25-26-22(27)28-14-8-13-23)18-15-20(16-9-4-3-5-10-16)24-19-12-7-6-11-17(18)19/h3-7,9-12,15H,2,8,14H2,1H3 |
| InChIKey | SLLUFTOFQCENBB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|