C18H13Cl3N2OS — CID 7754952
(2R)-2-quinolin-2-ylsulfanyl-N-(2,4,6-trichlorophenyl)propanamide (PubChem CID 7754952) has the molecular formula C18H13Cl3N2OS and a molecular weight of 411.74 g/mol. Its IUPAC name is (2R)-2-quinolin-2-ylsulfanyl-N-(2,4,6-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-quinolin-2-ylsulfanyl-N-(2,4,6-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 7754952 |
| Molecular Formula | C18H13Cl3N2OS |
| Molecular Weight | 411.74 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | (2R)-2-quinolin-2-ylsulfanyl-N-(2,4,6-trichlorophenyl)propanamide |
| SMILES | C[C@@H](Sc1ccc2ccccc2n1)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl3N2OS/c1-10(18(24)23-17-13(20)8-12(19)9-14(17)21)25-16-7-6-11-4-2-3-5-15(11)22-16/h2-10H,1H3,(H,23,24)/t10-/m1/s1 |
| InChIKey | KAWFDNNPXFMZMQ-SNVBAGLBSA-N |
| XLogP | 6.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.74 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |