C11H8N4O4S — CID 7756818
1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4,5-trione (PubChem CID 7756818) has the molecular formula C11H8N4O4S and a molecular weight of 292.28 g/mol. Its IUPAC name is 1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 7756818 |
| Molecular Formula | C11H8N4O4S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 1-methyl-3-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl]imidazolidine-2,4,5-trione |
| SMILES | CN1C(=O)C(=O)N(Cc2cc(=O)n3ccsc3n2)C1=O |
| InChI | InChI=1S/C11H8N4O4S/c1-13-8(17)9(18)15(11(13)19)5-6-4-7(16)14-2-3-20-10(14)12-6/h2-4H,5H2,1H3 |
| InChIKey | GCVNEDCPDBEDCM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 92.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|