About 1-(4-chlorophenyl)indole
1-(4-chlorophenyl)indole (PubChem CID 775716) has the molecular formula C14H10ClN
and a molecular weight of 227.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)indole.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)indole |
| PubChem CID | 775716 |
| Molecular Formula | C14H10ClN |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 1-(4-chlorophenyl)indole |
| SMILES | Clc1ccc(-n2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C14H10ClN/c15-12-5-7-13(8-6-12)16-10-9-11-3-1-2-4-14(11)16/h1-10H |
| InChIKey | KHYIDGIPLSNPHO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-chlorophenyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)indole?
The IUPAC name of 1-(4-chlorophenyl)indole (CID 775716) is 1-(4-chlorophenyl)indole.
What is the SMILES notation for 1-(4-chlorophenyl)indole?
The canonical SMILES for 1-(4-chlorophenyl)indole is Clc1ccc(-n2ccc3ccccc32)cc1.
What is the InChIKey of 1-(4-chlorophenyl)indole?
The InChIKey is KHYIDGIPLSNPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClN/c15-12-5-7-13(8-6-12)16-10-9-11-3-1-2-4-14(11)16/h1-10H.
What are the key properties of 1-(4-chlorophenyl)indole?
1-(4-chlorophenyl)indole has a molecular weight of 227.69 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)indole is sourced from PubChem (CID 775716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).