About butan-2-yl acetate
butan-2-yl acetate (PubChem CID 7758) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is butan-2-yl acetate.
Molecular Properties
| Compound Name | butan-2-yl acetate |
| PubChem CID | 7758 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | butan-2-yl acetate |
| SMILES | CCC(C)OC(C)=O |
| InChI | InChI=1S/C6H12O2/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3 |
| InChIKey | DCKVNWZUADLDEH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl acetate?
The IUPAC name of butan-2-yl acetate (CID 7758) is butan-2-yl acetate.
What is the SMILES notation for butan-2-yl acetate?
The canonical SMILES for butan-2-yl acetate is CCC(C)OC(C)=O.
What is the InChIKey of butan-2-yl acetate?
The InChIKey is DCKVNWZUADLDEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-4-5(2)8-6(3)7/h5H,4H2,1-3H3.
What are the key properties of butan-2-yl acetate?
butan-2-yl acetate has a molecular weight of 116.16 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl acetate is sourced from PubChem (CID 7758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).