About [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate (PubChem CID 7759022) has the molecular formula C22H26FNO5
and a molecular weight of 403.45 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate.
Molecular Properties
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate |
| PubChem CID | 7759022 |
| Molecular Formula | C22H26FNO5 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)Cc2ccc(F)cc2)cc1OCC |
| InChI | InChI=1S/C22H26FNO5/c1-3-27-19-10-7-17(13-20(19)28-4-2)11-12-24-21(25)15-29-22(26)14-16-5-8-18(23)9-6-16/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H,24,25) |
| InChIKey | OFSNQWSRIXBXDY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate?
The IUPAC name of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate (CID 7759022) is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate.
What is the SMILES notation for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate?
The canonical SMILES for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate is CCOc1ccc(CCNC(=O)COC(=O)Cc2ccc(F)cc2)cc1OCC.
What is the InChIKey of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate?
The InChIKey is OFSNQWSRIXBXDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26FNO5/c1-3-27-19-10-7-17(13-20(19)28-4-2)11-12-24-21(25)15-29-22(26)14-16-5-8-18(23)9-6-16/h5-10,13H,3-4,11-12,14-15H2,1-2H3,(H,24,25).
What are the key properties of [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate?
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate has a molecular weight of 403.45 g/mol, XLogP of 3.07, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 2-(4-fluorophenyl)acetate is sourced from PubChem (CID 7759022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).