About 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid
3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid (PubChem CID 776058) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid |
| PubChem CID | 776058 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid |
| SMILES | Cc1n[nH]c(C)c1CCC(=O)O |
| InChI | InChI=1S/C8H12N2O2/c1-5-7(3-4-8(11)12)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | NKTYLFMWIMKAKT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid (CID 776058) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid is Cc1n[nH]c(C)c1CCC(=O)O.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
The InChIKey is NKTYLFMWIMKAKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-7(3-4-8(11)12)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)(H,11,12).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid has a molecular weight of 168.20 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid is sourced from PubChem (CID 776058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).