3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid

C8H12N2O2 — CID 776058

IUPAC3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid
SMILESCc1n[nH]c(C)c1CCC(=O)O
InChIInChI=1S/C8H12N2O2/c1-5-7(3-4-8(11)12)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyNKTYLFMWIMKAKT-UHFFFAOYSA-N
MW168.20 g/mol
LogP1.04
Rot. Bonds3

About 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid

3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid (PubChem CID 776058) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid.

Molecular Properties

Compound Name3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid
PubChem CID776058
Molecular FormulaC8H12N2O2
Molecular Weight168.20 g/mol
Exact Mass168.09
IUPAC Name3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid
SMILESCc1n[nH]c(C)c1CCC(=O)O
InChIInChI=1S/C8H12N2O2/c1-5-7(3-4-8(11)12)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyNKTYLFMWIMKAKT-UHFFFAOYSA-N
XLogP1.04
TPSA65.98 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.20
LogP ≤ 51.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
The IUPAC name of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid (CID 776058) is 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
The canonical SMILES for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid is Cc1n[nH]c(C)c1CCC(=O)O.
What is the InChIKey of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
The InChIKey is NKTYLFMWIMKAKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5-7(3-4-8(11)12)6(2)10-9-5/h3-4H2,1-2H3,(H,9,10)(H,11,12).
What are the key properties of 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid?
3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid has a molecular weight of 168.20 g/mol, XLogP of 1.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethyl-1H-pyrazol-4-yl)propanoic acid is sourced from PubChem (CID 776058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).