C21H21N3O3S — CID 7760850
N,N-dimethyl-4-[(N-phenylanilino)carbamoyl]benzenesulfonamide (PubChem CID 7760850) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is N,N-dimethyl-4-[(N-phenylanilino)carbamoyl]benzenesulfonamide.
| Compound Name | N,N-dimethyl-4-[(N-phenylanilino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 7760850 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | N,N-dimethyl-4-[(N-phenylanilino)carbamoyl]benzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)NN(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-23(2)28(26,27)20-15-13-17(14-16-20)21(25)22-24(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-16H,1-2H3,(H,22,25) |
| InChIKey | CDBHCEYMIRMVSS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|