C23H32O4 — CID 7761417
2-[(1R,3E,7E,9S,10S)-9-hydroxy-3,7-dimethyl-10-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-1-(4-hydroxyphenyl)ethanone (PubChem CID 7761417) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[(1R,3E,7E,9S,10S)-9-hydroxy-3,7-dimethyl-10-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-1-(4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(1R,3E,7E,9S,10S)-9-hydroxy-3,7-dimethyl-10-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-1-(4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 7761417 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 2-[(1R,3E,7E,9S,10S)-9-hydroxy-3,7-dimethyl-10-propan-2-ylcyclodeca-3,7-dien-1-yl]oxy-1-(4-hydroxyphenyl)ethanone |
| SMILES | C/C1=C\[C@H](O)[C@H](C(C)C)[C@H](OCC(=O)c2ccc(O)cc2)C/C(C)=C/CC1 |
| InChI | InChI=1S/C23H32O4/c1-15(2)23-20(25)12-16(3)6-5-7-17(4)13-22(23)27-14-21(26)18-8-10-19(24)11-9-18/h7-12,15,20,22-25H,5-6,13-14H2,1-4H3/b16-12+,17-7+/t20-,22+,23-/m0/s1 |
| InChIKey | HDAGALPNSCGMSL-DAHLUULSSA-N |
| XLogP | 4.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|