C18H19NO2 — CID 7762179
(2S,3aR)-2-hydroxy-11,11-dimethyl-2,3,3a,10-tetrahydronaphtho[1,2-g]indolizin-1-one (PubChem CID 7762179) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (2S,3aR)-2-hydroxy-11,11-dimethyl-2,3,3a,10-tetrahydronaphtho[1,2-g]indolizin-1-one.
| Compound Name | (2S,3aR)-2-hydroxy-11,11-dimethyl-2,3,3a,10-tetrahydronaphtho[1,2-g]indolizin-1-one |
|---|---|
| PubChem CID | 7762179 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2S,3aR)-2-hydroxy-11,11-dimethyl-2,3,3a,10-tetrahydronaphtho[1,2-g]indolizin-1-one |
| SMILES | CC1(C)Cc2c(ccc3ccccc23)[C@H]2C[C@H](O)C(=O)N21 |
| InChI | InChI=1S/C18H19NO2/c1-18(2)10-14-12-6-4-3-5-11(12)7-8-13(14)15-9-16(20)17(21)19(15)18/h3-8,15-16,20H,9-10H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | PQSPEAWANLURSD-CVEARBPZSA-N |
| XLogP | 2.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |