About 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole
5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole (PubChem CID 7762332) has the molecular formula C16H15BrN4O2S
and a molecular weight of 407.29 g/mol. Its IUPAC name is 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole.
Molecular Properties
| Compound Name | 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole |
| PubChem CID | 7762332 |
| Molecular Formula | C16H15BrN4O2S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole |
| SMILES | COc1cc(CSc2nnnn2-c2ccccc2)c(OC)cc1Br |
| InChI | InChI=1S/C16H15BrN4O2S/c1-22-14-9-13(17)15(23-2)8-11(14)10-24-16-18-19-20-21(16)12-6-4-3-5-7-12/h3-9H,10H2,1-2H3 |
| InChIKey | VNPXKILCOXEBGQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole?
The IUPAC name of 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole (CID 7762332) is 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole.
What is the SMILES notation for 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole?
The canonical SMILES for 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole is COc1cc(CSc2nnnn2-c2ccccc2)c(OC)cc1Br.
What is the InChIKey of 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole?
The InChIKey is VNPXKILCOXEBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN4O2S/c1-22-14-9-13(17)15(23-2)8-11(14)10-24-16-18-19-20-21(16)12-6-4-3-5-7-12/h3-9H,10H2,1-2H3.
What are the key properties of 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole?
5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole has a molecular weight of 407.29 g/mol, XLogP of 3.73, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-bromo-2,5-dimethoxyphenyl)methylsulfanyl]-1-phenyltetrazole is sourced from PubChem (CID 7762332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).