About N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide
N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide (PubChem CID 7762538) has the molecular formula C14H18N4O3S
and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide |
| PubChem CID | 7762538 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C14H18N4O3S/c1-9-14(10(2)18(4)16-9)17-22(20,21)13-7-5-12(6-8-13)15-11(3)19/h5-8,17H,1-4H3,(H,15,19) |
| InChIKey | DZRNKUZLHFZXTI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide?
The IUPAC name of N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide (CID 7762538) is N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide is CC(=O)Nc1ccc(S(=O)(=O)Nc2c(C)nn(C)c2C)cc1.
What is the InChIKey of N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide?
The InChIKey is DZRNKUZLHFZXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O3S/c1-9-14(10(2)18(4)16-9)17-22(20,21)13-7-5-12(6-8-13)15-11(3)19/h5-8,17H,1-4H3,(H,15,19).
What are the key properties of N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide?
N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide has a molecular weight of 322.39 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1,3,5-trimethylpyrazol-4-yl)sulfamoyl]phenyl]acetamide is sourced from PubChem (CID 7762538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).