C19H20N2O4 — CID 7763027
N-(2,3-dimethylphenyl)-2-[[2-(2-formylphenoxy)acetyl]amino]acetamide (PubChem CID 7763027) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[[2-(2-formylphenoxy)acetyl]amino]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[[2-(2-formylphenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 7763027 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[[2-(2-formylphenoxy)acetyl]amino]acetamide |
| SMILES | Cc1cccc(NC(=O)CNC(=O)COc2ccccc2C=O)c1C |
| InChI | InChI=1S/C19H20N2O4/c1-13-6-5-8-16(14(13)2)21-18(23)10-20-19(24)12-25-17-9-4-3-7-15(17)11-22/h3-9,11H,10,12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | VBHHPWVXPIKRQA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|