C21H24N2O5S — CID 7763032
2-(2-formylphenoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 7763032) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is 2-(2-formylphenoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2-formylphenoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 7763032 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-(2-formylphenoxy)-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccccc2C=O)cc1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H24N2O5S/c1-16-9-10-18(13-20(16)29(26,27)23-11-5-2-6-12-23)22-21(25)15-28-19-8-4-3-7-17(19)14-24/h3-4,7-10,13-14H,2,5-6,11-12,15H2,1H3,(H,22,25) |
| InChIKey | RYSGAOWPEVLRMD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|