About (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone
(3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 776356) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone.
Molecular Properties
| Compound Name | (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone |
| PubChem CID | 776356 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | CCOc1ccc(C(=O)N2CCc3ccccc32)cc1OCC |
| InChI | InChI=1S/C19H21NO3/c1-3-22-17-10-9-15(13-18(17)23-4-2)19(21)20-12-11-14-7-5-6-8-16(14)20/h5-10,13H,3-4,11-12H2,1-2H3 |
| InChIKey | WYVXVGVGQCQVKZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone?
The IUPAC name of (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone (CID 776356) is (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone.
What is the SMILES notation for (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone?
The canonical SMILES for (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone is CCOc1ccc(C(=O)N2CCc3ccccc32)cc1OCC.
What is the InChIKey of (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone?
The InChIKey is WYVXVGVGQCQVKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-3-22-17-10-9-15(13-18(17)23-4-2)19(21)20-12-11-14-7-5-6-8-16(14)20/h5-10,13H,3-4,11-12H2,1-2H3.
What are the key properties of (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone?
(3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone has a molecular weight of 311.38 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diethoxyphenyl)-(2,3-dihydroindol-1-yl)methanone is sourced from PubChem (CID 776356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).