C17H14Cl3NO3 — CID 7763805
(2R)-2-(4-acetylphenoxy)-N-(2,4,6-trichlorophenyl)propanamide (PubChem CID 7763805) has the molecular formula C17H14Cl3NO3 and a molecular weight of 386.66 g/mol. Its IUPAC name is (2R)-2-(4-acetylphenoxy)-N-(2,4,6-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-(4-acetylphenoxy)-N-(2,4,6-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 7763805 |
| Molecular Formula | C17H14Cl3NO3 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | (2R)-2-(4-acetylphenoxy)-N-(2,4,6-trichlorophenyl)propanamide |
| SMILES | CC(=O)c1ccc(O[C@H](C)C(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H14Cl3NO3/c1-9(22)11-3-5-13(6-4-11)24-10(2)17(23)21-16-14(19)7-12(18)8-15(16)20/h3-8,10H,1-2H3,(H,21,23)/t10-/m1/s1 |
| InChIKey | IMBBWXJNEHPOEX-SNVBAGLBSA-N |
| XLogP | 5.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |