C20H24N2O5S — CID 7763890
(2R)-2-(4-acetylphenoxy)-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 7763890) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is (2R)-2-(4-acetylphenoxy)-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | (2R)-2-(4-acetylphenoxy)-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 7763890 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2R)-2-(4-acetylphenoxy)-N-[4-(propan-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | CC(=O)c1ccc(O[C@H](C)C(=O)Nc2ccc(S(=O)(=O)NC(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O5S/c1-13(2)22-28(25,26)19-11-7-17(8-12-19)21-20(24)15(4)27-18-9-5-16(6-10-18)14(3)23/h5-13,15,22H,1-4H3,(H,21,24)/t15-/m1/s1 |
| InChIKey | YXXAVUCMXPODEV-OAHLLOKOSA-N |
| XLogP | 2.98 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |