C18H18ClNO3 — CID 7764866
[(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate (PubChem CID 7764866) has the molecular formula C18H18ClNO3 and a molecular weight of 331.80 g/mol. Its IUPAC name is [(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate.
| Compound Name | [(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 7764866 |
| Molecular Formula | C18H18ClNO3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [(2S)-1-(3,4-dimethylphenyl)-1-oxopropan-2-yl] 3-amino-4-chlorobenzoate |
| SMILES | Cc1ccc(C(=O)[C@H](C)OC(=O)c2ccc(Cl)c(N)c2)cc1C |
| InChI | InChI=1S/C18H18ClNO3/c1-10-4-5-13(8-11(10)2)17(21)12(3)23-18(22)14-6-7-15(19)16(20)9-14/h4-9,12H,20H2,1-3H3/t12-/m0/s1 |
| InChIKey | KPWVRJSRMOSPRJ-LBPRGKRZSA-N |
| XLogP | 3.97 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|