About 3-thiophen-3-yl-1,2-oxazole-5-carboxamide
3-thiophen-3-yl-1,2-oxazole-5-carboxamide (PubChem CID 776506) has the molecular formula C8H6N2O2S
and a molecular weight of 194.22 g/mol. Its IUPAC name is 3-thiophen-3-yl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-thiophen-3-yl-1,2-oxazole-5-carboxamide |
| PubChem CID | 776506 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 3-thiophen-3-yl-1,2-oxazole-5-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccsc2)no1 |
| InChI | InChI=1S/C8H6N2O2S/c9-8(11)7-3-6(10-12-7)5-1-2-13-4-5/h1-4H,(H2,9,11) |
| InChIKey | JXPAZVGJXBJSDM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-thiophen-3-yl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-3-yl-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-thiophen-3-yl-1,2-oxazole-5-carboxamide (CID 776506) is 3-thiophen-3-yl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-thiophen-3-yl-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-thiophen-3-yl-1,2-oxazole-5-carboxamide is NC(=O)c1cc(-c2ccsc2)no1.
What is the InChIKey of 3-thiophen-3-yl-1,2-oxazole-5-carboxamide?
The InChIKey is JXPAZVGJXBJSDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2S/c9-8(11)7-3-6(10-12-7)5-1-2-13-4-5/h1-4H,(H2,9,11).
What are the key properties of 3-thiophen-3-yl-1,2-oxazole-5-carboxamide?
3-thiophen-3-yl-1,2-oxazole-5-carboxamide has a molecular weight of 194.22 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-3-yl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 776506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).