About 8-N,8-N-dimethyl-7H-purine-6,8-diamine
8-N,8-N-dimethyl-7H-purine-6,8-diamine (PubChem CID 776561) has the molecular formula C7H10N6
and a molecular weight of 178.20 g/mol. Its IUPAC name is 8-N,8-N-dimethyl-7H-purine-6,8-diamine.
Molecular Properties
| Compound Name | 8-N,8-N-dimethyl-7H-purine-6,8-diamine |
| PubChem CID | 776561 |
| Molecular Formula | C7H10N6 |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 8-N,8-N-dimethyl-7H-purine-6,8-diamine |
| SMILES | CN(C)c1nc2ncnc(N)c2[nH]1 |
| InChI | InChI=1S/C7H10N6/c1-13(2)7-11-4-5(8)9-3-10-6(4)12-7/h3H,1-2H3,(H3,8,9,10,11,12) |
| InChIKey | IJLZPLBXRPFQHT-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-N,8-N-dimethyl-7H-purine-6,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-N,8-N-dimethyl-7H-purine-6,8-diamine?
The IUPAC name of 8-N,8-N-dimethyl-7H-purine-6,8-diamine (CID 776561) is 8-N,8-N-dimethyl-7H-purine-6,8-diamine.
What is the SMILES notation for 8-N,8-N-dimethyl-7H-purine-6,8-diamine?
The canonical SMILES for 8-N,8-N-dimethyl-7H-purine-6,8-diamine is CN(C)c1nc2ncnc(N)c2[nH]1.
What is the InChIKey of 8-N,8-N-dimethyl-7H-purine-6,8-diamine?
The InChIKey is IJLZPLBXRPFQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6/c1-13(2)7-11-4-5(8)9-3-10-6(4)12-7/h3H,1-2H3,(H3,8,9,10,11,12).
What are the key properties of 8-N,8-N-dimethyl-7H-purine-6,8-diamine?
8-N,8-N-dimethyl-7H-purine-6,8-diamine has a molecular weight of 178.20 g/mol, XLogP of 0.00, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-N,8-N-dimethyl-7H-purine-6,8-diamine is sourced from PubChem (CID 776561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).