About (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate (PubChem CID 7768275) has the molecular formula C16H10ClN3O5
and a molecular weight of 359.73 g/mol. Its IUPAC name is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate.
Molecular Properties
| Compound Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate |
| PubChem CID | 7768275 |
| Molecular Formula | C16H10ClN3O5 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate |
| SMILES | O=C(OCc1nc(-c2ccccc2)no1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H10ClN3O5/c17-12-7-6-11(8-13(12)20(22)23)16(21)24-9-14-18-15(19-25-14)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | PPTGQOVUNXYCGS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate?
The IUPAC name of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate (CID 7768275) is (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate.
What is the SMILES notation for (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate?
The canonical SMILES for (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate is O=C(OCc1nc(-c2ccccc2)no1)c1ccc(Cl)c([N+](=O)[O-])c1.
What is the InChIKey of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate?
The InChIKey is PPTGQOVUNXYCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3O5/c17-12-7-6-11(8-13(12)20(22)23)16(21)24-9-14-18-15(19-25-14)10-4-2-1-3-5-10/h1-8H,9H2.
What are the key properties of (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate?
(3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate has a molecular weight of 359.73 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-phenyl-1,2,4-oxadiazol-5-yl)methyl 4-chloro-3-nitrobenzoate is sourced from PubChem (CID 7768275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).