C10H8N6O2S — CID 776828
3-[(4-nitrophenyl)methylsulfanyl]-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole (PubChem CID 776828) has the molecular formula C10H8N6O2S and a molecular weight of 276.28 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)methylsulfanyl]-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole.
| Compound Name | 3-[(4-nitrophenyl)methylsulfanyl]-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole |
|---|---|
| PubChem CID | 776828 |
| Molecular Formula | C10H8N6O2S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-[(4-nitrophenyl)methylsulfanyl]-5H-[1,2,4]triazolo[4,3-b][1,2,4]triazole |
| SMILES | O=[N+]([O-])c1ccc(CSc2nnc3nc[nH]n23)cc1 |
| InChI | InChI=1S/C10H8N6O2S/c17-16(18)8-3-1-7(2-4-8)5-19-10-14-13-9-11-6-12-15(9)10/h1-4,6H,5H2,(H,11,12,13) |
| InChIKey | PVRDQCYQVDDFPR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|