About quinoxaline-5-carboxylic acid
quinoxaline-5-carboxylic acid (PubChem CID 776833) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is quinoxaline-5-carboxylic acid.
Molecular Properties
| Compound Name | quinoxaline-5-carboxylic acid |
| PubChem CID | 776833 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | quinoxaline-5-carboxylic acid |
| SMILES | O=C(O)c1cccc2nccnc12 |
| InChI | InChI=1S/C9H6N2O2/c12-9(13)6-2-1-3-7-8(6)11-5-4-10-7/h1-5H,(H,12,13) |
| InChIKey | QLZNISOPACYKOR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze quinoxaline-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoxaline-5-carboxylic acid?
The IUPAC name of quinoxaline-5-carboxylic acid (CID 776833) is quinoxaline-5-carboxylic acid.
What is the SMILES notation for quinoxaline-5-carboxylic acid?
The canonical SMILES for quinoxaline-5-carboxylic acid is O=C(O)c1cccc2nccnc12.
What is the InChIKey of quinoxaline-5-carboxylic acid?
The InChIKey is QLZNISOPACYKOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-9(13)6-2-1-3-7-8(6)11-5-4-10-7/h1-5H,(H,12,13).
What are the key properties of quinoxaline-5-carboxylic acid?
quinoxaline-5-carboxylic acid has a molecular weight of 174.16 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoxaline-5-carboxylic acid is sourced from PubChem (CID 776833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).