About 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline
3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline (PubChem CID 776878) has the molecular formula C13H16N2O
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline.
Molecular Properties
| Compound Name | 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline |
| PubChem CID | 776878 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1-n1c(C)ccc1C |
| InChI | InChI=1S/C13H16N2O/c1-9-4-5-10(2)15(9)12-8-11(14)6-7-13(12)16-3/h4-8H,14H2,1-3H3 |
| InChIKey | VUEBXYJBULSCQG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline?
The IUPAC name of 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline (CID 776878) is 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline.
What is the SMILES notation for 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline?
The canonical SMILES for 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline is COc1ccc(N)cc1-n1c(C)ccc1C.
What is the InChIKey of 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline?
The InChIKey is VUEBXYJBULSCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O/c1-9-4-5-10(2)15(9)12-8-11(14)6-7-13(12)16-3/h4-8H,14H2,1-3H3.
What are the key properties of 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline?
3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline has a molecular weight of 216.28 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethylpyrrol-1-yl)-4-methoxyaniline is sourced from PubChem (CID 776878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).