C16H12F3NO2 — CID 7769944
(E)-3-(4-methoxyphenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide (PubChem CID 7769944) has the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7769944 |
| Molecular Formula | C16H12F3NO2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-(2,3,4-trifluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H12F3NO2/c1-22-11-5-2-10(3-6-11)4-9-14(21)20-13-8-7-12(17)15(18)16(13)19/h2-9H,1H3,(H,20,21)/b9-4+ |
| InChIKey | RMDVNDYJRZSQHO-RUDMXATFSA-N |
| XLogP | 3.76 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|