C15H17N3O3S — CID 7771070
3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 7771070) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 7771070 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1csc(NC(=O)CCN2C(=O)[C@H]3CC=CC[C@H]3C2=O)n1 |
| InChI | InChI=1S/C15H17N3O3S/c1-9-8-22-15(16-9)17-12(19)6-7-18-13(20)10-4-2-3-5-11(10)14(18)21/h2-3,8,10-11H,4-7H2,1H3,(H,16,17,19)/t10-,11+ |
| InChIKey | IBBABMOZFFJQQE-PHIMTYICSA-N |
| XLogP | 1.73 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|