C22H24N2O3S — CID 7771601
(4S)-3'-[2-oxo-2-(2,3,4,6-tetramethylphenyl)ethyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 7771601) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (4S)-3'-[2-oxo-2-(2,3,4,6-tetramethylphenyl)ethyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | (4S)-3'-[2-oxo-2-(2,3,4,6-tetramethylphenyl)ethyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 7771601 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (4S)-3'-[2-oxo-2-(2,3,4,6-tetramethylphenyl)ethyl]spiro[6,7-dihydro-5H-1-benzothiophene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | Cc1cc(C)c(C(=O)CN2C(=O)N[C@]3(CCCc4sccc43)C2=O)c(C)c1C |
| InChI | InChI=1S/C22H24N2O3S/c1-12-10-13(2)19(15(4)14(12)3)17(25)11-24-20(26)22(23-21(24)27)8-5-6-18-16(22)7-9-28-18/h7,9-10H,5-6,8,11H2,1-4H3,(H,23,27)/t22-/m0/s1 |
| InChIKey | BBFIDLNSJNNXES-QFIPXVFZSA-N |
| XLogP | 3.95 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|