C18H13F2NO — CID 7771712
N-(3,4-difluorophenyl)-2-naphthalen-1-ylacetamide (PubChem CID 7771712) has the molecular formula C18H13F2NO and a molecular weight of 297.30 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 7771712 |
| Molecular Formula | C18H13F2NO |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H13F2NO/c19-16-9-8-14(11-17(16)20)21-18(22)10-13-6-3-5-12-4-1-2-7-15(12)13/h1-9,11H,10H2,(H,21,22) |
| InChIKey | YZKQRINZCZLJAN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |