C18H23N3O3S — CID 7771781
2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 7771781) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 7771781 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)CN1C(=O)N[C@@]2(CCCc3sccc32)C1=O |
| InChI | InChI=1S/C18H23N3O3S/c1-4-20(10-12(2)3)15(22)11-21-16(23)18(19-17(21)24)8-5-6-14-13(18)7-9-25-14/h7,9H,2,4-6,8,10-11H2,1,3H3,(H,19,24)/t18-/m1/s1 |
| InChIKey | QLEUUQNDCCUBIL-GOSISDBHSA-N |
| XLogP | 2.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|