About 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione
1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione (PubChem CID 777231) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione |
| PubChem CID | 777231 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione |
| SMILES | Cn1c(NCCc2ccccc2)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H17N3O2/c1-16-12(10-13(18)17(2)14(16)19)15-9-8-11-6-4-3-5-7-11/h3-7,10,15H,8-9H2,1-2H3 |
| InChIKey | XUGVMBMQHABPQC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione?
The IUPAC name of 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione (CID 777231) is 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione.
What is the SMILES notation for 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione?
The canonical SMILES for 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione is Cn1c(NCCc2ccccc2)cc(=O)n(C)c1=O.
What is the InChIKey of 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione?
The InChIKey is XUGVMBMQHABPQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c1-16-12(10-13(18)17(2)14(16)19)15-9-8-11-6-4-3-5-7-11/h3-7,10,15H,8-9H2,1-2H3.
What are the key properties of 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione?
1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione has a molecular weight of 259.31 g/mol, XLogP of 0.74, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-6-(2-phenylethylamino)pyrimidine-2,4-dione is sourced from PubChem (CID 777231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).