C21H23N3O3S — CID 7772467
2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 7772467) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 7772467 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2-[(4R)-2',5'-dioxospiro[6,7-dihydro-5H-1-benzothiophene-4,4'-imidazolidine]-1'-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)N[C@@]2(CCCc3sccc32)C1=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C21H23N3O3S/c25-18(22-12-5-8-15-6-2-1-3-7-15)14-24-19(26)21(23-20(24)27)11-4-9-17-16(21)10-13-28-17/h1-3,6-7,10,13H,4-5,8-9,11-12,14H2,(H,22,25)(H,23,27)/t21-/m1/s1 |
| InChIKey | PJTRWZOCHNYKCR-OAQYLSRUSA-N |
| XLogP | 2.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|