C19H22N2O5 — CID 7772605
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R,3R)-3-methyl-2-phenylpentanoate (PubChem CID 7772605) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R,3R)-3-methyl-2-phenylpentanoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R,3R)-3-methyl-2-phenylpentanoate |
|---|---|
| PubChem CID | 7772605 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (2R,3R)-3-methyl-2-phenylpentanoate |
| SMILES | CC[C@@H](C)[C@@H](C(=O)OCC(=O)NNC(=O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O5/c1-3-13(2)17(14-8-5-4-6-9-14)19(24)26-12-16(22)20-21-18(23)15-10-7-11-25-15/h4-11,13,17H,3,12H2,1-2H3,(H,20,22)(H,21,23)/t13-,17-/m1/s1 |
| InChIKey | JOJIPNNLELIFOB-CXAGYDPISA-N |
| XLogP | 2.41 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|